C22H23N9O2 — CID 126680037
2-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]-5-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]benzonitrile (PubChem CID 126680037) has the molecular formula C22H23N9O2 and a molecular weight of 445.49 g/mol. Its IUPAC name is 2-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]-5-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]benzonitrile.
| Compound Name | 2-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]-5-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 126680037 |
| Molecular Formula | C22H23N9O2 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 2-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]-5-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]benzonitrile |
| SMILES | N#Cc1cc(-c2ccc(N3CCNC(=O)C3)nc2)ccc1COc1cc(N)nc(NN)c1N |
| InChI | InChI=1S/C22H23N9O2/c23-9-16-7-13(14-3-4-19(28-10-14)31-6-5-27-20(32)11-31)1-2-15(16)12-33-17-8-18(24)29-22(30-26)21(17)25/h1-4,7-8,10H,5-6,11-12,25-26H2,(H,27,32)(H3,24,29,30) |
| InChIKey | QCBZVGQSWOBTHV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 181.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|