C16H11F3N2 — CID 175276620
1-phenyl-4-[(2,3,5-trifluorophenyl)methyl]pyrazole (PubChem CID 175276620) has the molecular formula C16H11F3N2 and a molecular weight of 288.27 g/mol. Its IUPAC name is 1-phenyl-4-[(2,3,5-trifluorophenyl)methyl]pyrazole.
| Compound Name | 1-phenyl-4-[(2,3,5-trifluorophenyl)methyl]pyrazole |
|---|---|
| PubChem CID | 175276620 |
| Molecular Formula | C16H11F3N2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1-phenyl-4-[(2,3,5-trifluorophenyl)methyl]pyrazole |
| SMILES | Fc1cc(F)c(F)c(Cc2cnn(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C16H11F3N2/c17-13-7-12(16(19)15(18)8-13)6-11-9-20-21(10-11)14-4-2-1-3-5-14/h1-5,7-10H,6H2 |
| InChIKey | SYRIPFLVNFNPOB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|