C27H33N9 — CID 126676750
4-[[1-[[3-(2-benzylpiperazin-1-yl)phenyl]methyl]pyrazol-4-yl]methyl]-6-hydrazinylpyridine-2,5-diamine (PubChem CID 126676750) has the molecular formula C27H33N9 and a molecular weight of 483.62 g/mol. Its IUPAC name is 4-[[1-[[3-(2-benzylpiperazin-1-yl)phenyl]methyl]pyrazol-4-yl]methyl]-6-hydrazinylpyridine-2,5-diamine.
| Compound Name | 4-[[1-[[3-(2-benzylpiperazin-1-yl)phenyl]methyl]pyrazol-4-yl]methyl]-6-hydrazinylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 126676750 |
| Molecular Formula | C27H33N9 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | 4-[[1-[[3-(2-benzylpiperazin-1-yl)phenyl]methyl]pyrazol-4-yl]methyl]-6-hydrazinylpyridine-2,5-diamine |
| SMILES | NNc1nc(N)cc(Cc2cnn(Cc3cccc(N4CCNCC4Cc4ccccc4)c3)c2)c1N |
| InChI | InChI=1S/C27H33N9/c28-25-14-22(26(29)27(33-25)34-30)11-21-15-32-35(18-21)17-20-7-4-8-23(13-20)36-10-9-31-16-24(36)12-19-5-2-1-3-6-19/h1-8,13-15,18,24,31H,9-12,16-17,29-30H2,(H3,28,33,34) |
| InChIKey | YUWUIKCIENCEIO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|