C23H26FNO3 — CID 142873059
ethane;methyl 5-ethyl-3-[(4-fluorophenyl)methyl]-8-methoxyquinoline-7-carboxylate (PubChem CID 142873059) has the molecular formula C23H26FNO3 and a molecular weight of 383.46 g/mol. Its IUPAC name is ethane;methyl 5-ethyl-3-[(4-fluorophenyl)methyl]-8-methoxyquinoline-7-carboxylate.
| Compound Name | ethane;methyl 5-ethyl-3-[(4-fluorophenyl)methyl]-8-methoxyquinoline-7-carboxylate |
|---|---|
| PubChem CID | 142873059 |
| Molecular Formula | C23H26FNO3 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | ethane;methyl 5-ethyl-3-[(4-fluorophenyl)methyl]-8-methoxyquinoline-7-carboxylate |
| SMILES | CC.CCc1cc(C(=O)OC)c(OC)c2ncc(Cc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C21H20FNO3.C2H6/c1-4-15-11-18(21(24)26-3)20(25-2)19-17(15)10-14(12-23-19)9-13-5-7-16(22)8-6-13;1-2/h5-8,10-12H,4,9H2,1-3H3;1-2H3 |
| InChIKey | NZKBBDUNOGPQKT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |