C21H20FNO5 — CID 89053438
7-(ethylperoxymethyl)-3-[(4-fluorophenyl)methyl]-8-methoxyquinoline-5-carboxylic acid (PubChem CID 89053438) has the molecular formula C21H20FNO5 and a molecular weight of 385.39 g/mol. Its IUPAC name is 7-(ethylperoxymethyl)-3-[(4-fluorophenyl)methyl]-8-methoxyquinoline-5-carboxylic acid.
| Compound Name | 7-(ethylperoxymethyl)-3-[(4-fluorophenyl)methyl]-8-methoxyquinoline-5-carboxylic acid |
|---|---|
| PubChem CID | 89053438 |
| Molecular Formula | C21H20FNO5 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 7-(ethylperoxymethyl)-3-[(4-fluorophenyl)methyl]-8-methoxyquinoline-5-carboxylic acid |
| SMILES | CCOOCc1cc(C(=O)O)c2cc(Cc3ccc(F)cc3)cnc2c1OC |
| InChI | InChI=1S/C21H20FNO5/c1-3-27-28-12-15-10-18(21(24)25)17-9-14(11-23-19(17)20(15)26-2)8-13-4-6-16(22)7-5-13/h4-7,9-11H,3,8,12H2,1-2H3,(H,24,25) |
| InChIKey | VRXBBMAXCGWDHK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|