C20H17FN2O3 — CID 89053434
7-(ethylperoxymethyl)-3-[(4-fluorophenyl)methyl]-8-hydroxyquinoline-5-carbonitrile (PubChem CID 89053434) has the molecular formula C20H17FN2O3 and a molecular weight of 352.37 g/mol. Its IUPAC name is 7-(ethylperoxymethyl)-3-[(4-fluorophenyl)methyl]-8-hydroxyquinoline-5-carbonitrile.
| Compound Name | 7-(ethylperoxymethyl)-3-[(4-fluorophenyl)methyl]-8-hydroxyquinoline-5-carbonitrile |
|---|---|
| PubChem CID | 89053434 |
| Molecular Formula | C20H17FN2O3 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 7-(ethylperoxymethyl)-3-[(4-fluorophenyl)methyl]-8-hydroxyquinoline-5-carbonitrile |
| SMILES | CCOOCc1cc(C#N)c2cc(Cc3ccc(F)cc3)cnc2c1O |
| InChI | InChI=1S/C20H17FN2O3/c1-2-25-26-12-16-9-15(10-22)18-8-14(11-23-19(18)20(16)24)7-13-3-5-17(21)6-4-13/h3-6,8-9,11,24H,2,7,12H2,1H3 |
| InChIKey | IMCCFIAFQJARHU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 75.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|