C21H18FNO6 — CID 68820294
3-[(4-fluorophenyl)methyl]-8-hydroxy-7-(2-methoxyethoxycarbonyl)quinoline-5-carboxylic acid (PubChem CID 68820294) has the molecular formula C21H18FNO6 and a molecular weight of 399.37 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-8-hydroxy-7-(2-methoxyethoxycarbonyl)quinoline-5-carboxylic acid.
| Compound Name | 3-[(4-fluorophenyl)methyl]-8-hydroxy-7-(2-methoxyethoxycarbonyl)quinoline-5-carboxylic acid |
|---|---|
| PubChem CID | 68820294 |
| Molecular Formula | C21H18FNO6 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-8-hydroxy-7-(2-methoxyethoxycarbonyl)quinoline-5-carboxylic acid |
| SMILES | COCCOC(=O)c1cc(C(=O)O)c2cc(Cc3ccc(F)cc3)cnc2c1O |
| InChI | InChI=1S/C21H18FNO6/c1-28-6-7-29-21(27)17-10-16(20(25)26)15-9-13(11-23-18(15)19(17)24)8-12-2-4-14(22)5-3-12/h2-5,9-11,24H,6-8H2,1H3,(H,25,26) |
| InChIKey | XPOBDMQEAWCBBX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|