C21H19FN2O5 — CID 59696459
methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-[(2-methoxyacetyl)amino]quinoline-7-carboxylate (PubChem CID 59696459) has the molecular formula C21H19FN2O5 and a molecular weight of 398.39 g/mol. Its IUPAC name is methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-[(2-methoxyacetyl)amino]quinoline-7-carboxylate.
| Compound Name | methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-[(2-methoxyacetyl)amino]quinoline-7-carboxylate |
|---|---|
| PubChem CID | 59696459 |
| Molecular Formula | C21H19FN2O5 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-[(2-methoxyacetyl)amino]quinoline-7-carboxylate |
| SMILES | COCC(=O)Nc1cc(C(=O)OC)c(O)c2ncc(Cc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C21H19FN2O5/c1-28-11-18(25)24-17-9-16(21(27)29-2)20(26)19-15(17)8-13(10-23-19)7-12-3-5-14(22)6-4-12/h3-6,8-10,26H,7,11H2,1-2H3,(H,24,25) |
| InChIKey | PGQLTDHNSHCISF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|