C26H21FN2O5 — CID 68820572
methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-[(2-phenoxyacetyl)amino]quinoline-7-carboxylate (PubChem CID 68820572) has the molecular formula C26H21FN2O5 and a molecular weight of 460.46 g/mol. Its IUPAC name is methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-[(2-phenoxyacetyl)amino]quinoline-7-carboxylate.
| Compound Name | methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-[(2-phenoxyacetyl)amino]quinoline-7-carboxylate |
|---|---|
| PubChem CID | 68820572 |
| Molecular Formula | C26H21FN2O5 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-[(2-phenoxyacetyl)amino]quinoline-7-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)COc2ccccc2)c2cc(Cc3ccc(F)cc3)cnc2c1O |
| InChI | InChI=1S/C26H21FN2O5/c1-33-26(32)21-13-22(29-23(30)15-34-19-5-3-2-4-6-19)20-12-17(14-28-24(20)25(21)31)11-16-7-9-18(27)10-8-16/h2-10,12-14,31H,11,15H2,1H3,(H,29,30) |
| InChIKey | YDIGXLMCSQEUMX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|