C24H22FN3O5 — CID 87717733
methyl 3-[(4-fluorophenyl)methyl]-5-(4-formylpiperazine-1-carbonyl)-8-hydroxyquinoline-7-carboxylate (PubChem CID 87717733) has the molecular formula C24H22FN3O5 and a molecular weight of 451.45 g/mol. Its IUPAC name is methyl 3-[(4-fluorophenyl)methyl]-5-(4-formylpiperazine-1-carbonyl)-8-hydroxyquinoline-7-carboxylate.
| Compound Name | methyl 3-[(4-fluorophenyl)methyl]-5-(4-formylpiperazine-1-carbonyl)-8-hydroxyquinoline-7-carboxylate |
|---|---|
| PubChem CID | 87717733 |
| Molecular Formula | C24H22FN3O5 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | methyl 3-[(4-fluorophenyl)methyl]-5-(4-formylpiperazine-1-carbonyl)-8-hydroxyquinoline-7-carboxylate |
| SMILES | COC(=O)c1cc(C(=O)N2CCN(C=O)CC2)c2cc(Cc3ccc(F)cc3)cnc2c1O |
| InChI | InChI=1S/C24H22FN3O5/c1-33-24(32)20-12-19(23(31)28-8-6-27(14-29)7-9-28)18-11-16(13-26-21(18)22(20)30)10-15-2-4-17(25)5-3-15/h2-5,11-14,30H,6-10H2,1H3 |
| InChIKey | CVFTYTNPVNGLCS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|