C19H17FN2O5S — CID 68821465
methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(methanesulfonamido)quinoline-7-carboxylate (PubChem CID 68821465) has the molecular formula C19H17FN2O5S and a molecular weight of 404.42 g/mol. Its IUPAC name is methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(methanesulfonamido)quinoline-7-carboxylate.
| Compound Name | methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(methanesulfonamido)quinoline-7-carboxylate |
|---|---|
| PubChem CID | 68821465 |
| Molecular Formula | C19H17FN2O5S |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(methanesulfonamido)quinoline-7-carboxylate |
| SMILES | COC(=O)c1cc(NS(C)(=O)=O)c2cc(Cc3ccc(F)cc3)cnc2c1O |
| InChI | InChI=1S/C19H17FN2O5S/c1-27-19(24)15-9-16(22-28(2,25)26)14-8-12(10-21-17(14)18(15)23)7-11-3-5-13(20)6-4-11/h3-6,8-10,22-23H,7H2,1-2H3 |
| InChIKey | GCTYQVLDVNTCDX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|