C20H18FN3O4 — CID 68822421
methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(methylaminocarbamoyl)quinoline-7-carboxylate (PubChem CID 68822421) has the molecular formula C20H18FN3O4 and a molecular weight of 383.38 g/mol. Its IUPAC name is methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(methylaminocarbamoyl)quinoline-7-carboxylate.
| Compound Name | methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(methylaminocarbamoyl)quinoline-7-carboxylate |
|---|---|
| PubChem CID | 68822421 |
| Molecular Formula | C20H18FN3O4 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(methylaminocarbamoyl)quinoline-7-carboxylate |
| SMILES | CNNC(=O)c1cc(C(=O)OC)c(O)c2ncc(Cc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C20H18FN3O4/c1-22-24-19(26)15-9-16(20(27)28-2)18(25)17-14(15)8-12(10-23-17)7-11-3-5-13(21)6-4-11/h3-6,8-10,22,25H,7H2,1-2H3,(H,24,26) |
| InChIKey | OIDSQFIGXXGXRL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|