C24H18FN3O6 — CID 68819922
methyl 3-[(4-fluorophenyl)methyl]-5-[(furan-2-carbonylamino)carbamoyl]-8-hydroxyquinoline-7-carboxylate (PubChem CID 68819922) has the molecular formula C24H18FN3O6 and a molecular weight of 463.42 g/mol. Its IUPAC name is methyl 3-[(4-fluorophenyl)methyl]-5-[(furan-2-carbonylamino)carbamoyl]-8-hydroxyquinoline-7-carboxylate.
| Compound Name | methyl 3-[(4-fluorophenyl)methyl]-5-[(furan-2-carbonylamino)carbamoyl]-8-hydroxyquinoline-7-carboxylate |
|---|---|
| PubChem CID | 68819922 |
| Molecular Formula | C24H18FN3O6 |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | methyl 3-[(4-fluorophenyl)methyl]-5-[(furan-2-carbonylamino)carbamoyl]-8-hydroxyquinoline-7-carboxylate |
| SMILES | COC(=O)c1cc(C(=O)NNC(=O)c2ccco2)c2cc(Cc3ccc(F)cc3)cnc2c1O |
| InChI | InChI=1S/C24H18FN3O6/c1-33-24(32)18-11-17(22(30)27-28-23(31)19-3-2-8-34-19)16-10-14(12-26-20(16)21(18)29)9-13-4-6-15(25)7-5-13/h2-8,10-12,29H,9H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | OUYDAHVPWQWHID-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 130.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|