C22H21FN4O5 — CID 68857767
methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-[[methyl(methylcarbamoyl)amino]carbamoyl]quinoline-7-carboxylate (PubChem CID 68857767) has the molecular formula C22H21FN4O5 and a molecular weight of 440.43 g/mol. Its IUPAC name is methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-[[methyl(methylcarbamoyl)amino]carbamoyl]quinoline-7-carboxylate.
| Compound Name | methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-[[methyl(methylcarbamoyl)amino]carbamoyl]quinoline-7-carboxylate |
|---|---|
| PubChem CID | 68857767 |
| Molecular Formula | C22H21FN4O5 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-[[methyl(methylcarbamoyl)amino]carbamoyl]quinoline-7-carboxylate |
| SMILES | CNC(=O)N(C)NC(=O)c1cc(C(=O)OC)c(O)c2ncc(Cc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C22H21FN4O5/c1-24-22(31)27(2)26-20(29)16-10-17(21(30)32-3)19(28)18-15(16)9-13(11-25-18)8-12-4-6-14(23)7-5-12/h4-7,9-11,28H,8H2,1-3H3,(H,24,31)(H,26,29) |
| InChIKey | ITPGISPTYFYVJW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|