C22H21FN2O5 — CID 59696263
methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(3-hydroxypropylcarbamoyl)quinoline-7-carboxylate (PubChem CID 59696263) has the molecular formula C22H21FN2O5 and a molecular weight of 412.42 g/mol. Its IUPAC name is methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(3-hydroxypropylcarbamoyl)quinoline-7-carboxylate.
| Compound Name | methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(3-hydroxypropylcarbamoyl)quinoline-7-carboxylate |
|---|---|
| PubChem CID | 59696263 |
| Molecular Formula | C22H21FN2O5 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(3-hydroxypropylcarbamoyl)quinoline-7-carboxylate |
| SMILES | COC(=O)c1cc(C(=O)NCCCO)c2cc(Cc3ccc(F)cc3)cnc2c1O |
| InChI | InChI=1S/C22H21FN2O5/c1-30-22(29)18-11-17(21(28)24-7-2-8-26)16-10-14(12-25-19(16)20(18)27)9-13-3-5-15(23)6-4-13/h3-6,10-12,26-27H,2,7-9H2,1H3,(H,24,28) |
| InChIKey | CZBTVRKCLPVVKV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|