C28H30FN3O6 — CID 59696545
(1-acetylpiperidin-4-yl) 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(2-methoxyethylcarbamoyl)quinoline-7-carboxylate (PubChem CID 59696545) has the molecular formula C28H30FN3O6 and a molecular weight of 523.56 g/mol. Its IUPAC name is (1-acetylpiperidin-4-yl) 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(2-methoxyethylcarbamoyl)quinoline-7-carboxylate.
| Compound Name | (1-acetylpiperidin-4-yl) 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(2-methoxyethylcarbamoyl)quinoline-7-carboxylate |
|---|---|
| PubChem CID | 59696545 |
| Molecular Formula | C28H30FN3O6 |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | (1-acetylpiperidin-4-yl) 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(2-methoxyethylcarbamoyl)quinoline-7-carboxylate |
| SMILES | COCCNC(=O)c1cc(C(=O)OC2CCN(C(C)=O)CC2)c(O)c2ncc(Cc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C28H30FN3O6/c1-17(33)32-10-7-21(8-11-32)38-28(36)24-15-23(27(35)30-9-12-37-2)22-14-19(16-31-25(22)26(24)34)13-18-3-5-20(29)6-4-18/h3-6,14-16,21,34H,7-13H2,1-2H3,(H,30,35) |
| InChIKey | JHEMHCKIMHIIPP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|