C30H29FN2O4 — CID 59696325
methyl 5-(butylcarbamoyl)-3-[(4-fluorophenyl)methyl]-8-phenylmethoxyquinoline-7-carboxylate (PubChem CID 59696325) has the molecular formula C30H29FN2O4 and a molecular weight of 500.57 g/mol. Its IUPAC name is methyl 5-(butylcarbamoyl)-3-[(4-fluorophenyl)methyl]-8-phenylmethoxyquinoline-7-carboxylate.
| Compound Name | methyl 5-(butylcarbamoyl)-3-[(4-fluorophenyl)methyl]-8-phenylmethoxyquinoline-7-carboxylate |
|---|---|
| PubChem CID | 59696325 |
| Molecular Formula | C30H29FN2O4 |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | methyl 5-(butylcarbamoyl)-3-[(4-fluorophenyl)methyl]-8-phenylmethoxyquinoline-7-carboxylate |
| SMILES | CCCCNC(=O)c1cc(C(=O)OC)c(OCc2ccccc2)c2ncc(Cc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C30H29FN2O4/c1-3-4-14-32-29(34)25-17-26(30(35)36-2)28(37-19-21-8-6-5-7-9-21)27-24(25)16-22(18-33-27)15-20-10-12-23(31)13-11-20/h5-13,16-18H,3-4,14-15,19H2,1-2H3,(H,32,34) |
| InChIKey | OOBMSLLNNKNCNE-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|