C19H16BrFN2O2 — CID 71056445
5-bromo-3-[(4-fluorophenyl)methyl]-8-methoxy-N-methylquinoline-7-carboxamide (PubChem CID 71056445) has the molecular formula C19H16BrFN2O2 and a molecular weight of 403.25 g/mol. Its IUPAC name is 5-bromo-3-[(4-fluorophenyl)methyl]-8-methoxy-N-methylquinoline-7-carboxamide.
| Compound Name | 5-bromo-3-[(4-fluorophenyl)methyl]-8-methoxy-N-methylquinoline-7-carboxamide |
|---|---|
| PubChem CID | 71056445 |
| Molecular Formula | C19H16BrFN2O2 |
| Molecular Weight | 403.25 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | 5-bromo-3-[(4-fluorophenyl)methyl]-8-methoxy-N-methylquinoline-7-carboxamide |
| SMILES | CNC(=O)c1cc(Br)c2cc(Cc3ccc(F)cc3)cnc2c1OC |
| InChI | InChI=1S/C19H16BrFN2O2/c1-22-19(24)15-9-16(20)14-8-12(10-23-17(14)18(15)25-2)7-11-3-5-13(21)6-4-11/h3-6,8-10H,7H2,1-2H3,(H,22,24) |
| InChIKey | FZMIICKWYMVMDX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.25 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |