C19H15BrFNO3 — CID 58762964
[5-bromo-3-[(4-fluorophenyl)methyl]-8-methoxyquinolin-7-yl] acetate (PubChem CID 58762964) has the molecular formula C19H15BrFNO3 and a molecular weight of 404.24 g/mol. Its IUPAC name is [5-bromo-3-[(4-fluorophenyl)methyl]-8-methoxyquinolin-7-yl] acetate.
| Compound Name | [5-bromo-3-[(4-fluorophenyl)methyl]-8-methoxyquinolin-7-yl] acetate |
|---|---|
| PubChem CID | 58762964 |
| Molecular Formula | C19H15BrFNO3 |
| Molecular Weight | 404.24 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | [5-bromo-3-[(4-fluorophenyl)methyl]-8-methoxyquinolin-7-yl] acetate |
| SMILES | COc1c(OC(C)=O)cc(Br)c2cc(Cc3ccc(F)cc3)cnc12 |
| InChI | InChI=1S/C19H15BrFNO3/c1-11(23)25-17-9-16(20)15-8-13(10-22-18(15)19(17)24-2)7-12-3-5-14(21)6-4-12/h3-6,8-10H,7H2,1-2H3 |
| InChIKey | JBTAJUULQAFCJR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.24 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|