C22H20FNO4 — CID 142873053
(E)-4-[3-[(4-fluorophenyl)methyl]-8-methoxy-7-methylperoxyquinolin-5-yl]but-3-en-2-one (PubChem CID 142873053) has the molecular formula C22H20FNO4 and a molecular weight of 381.40 g/mol. Its IUPAC name is (E)-4-[3-[(4-fluorophenyl)methyl]-8-methoxy-7-methylperoxyquinolin-5-yl]but-3-en-2-one.
| Compound Name | (E)-4-[3-[(4-fluorophenyl)methyl]-8-methoxy-7-methylperoxyquinolin-5-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 142873053 |
| Molecular Formula | C22H20FNO4 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | (E)-4-[3-[(4-fluorophenyl)methyl]-8-methoxy-7-methylperoxyquinolin-5-yl]but-3-en-2-one |
| SMILES | COOc1cc(/C=C/C(C)=O)c2cc(Cc3ccc(F)cc3)cnc2c1OC |
| InChI | InChI=1S/C22H20FNO4/c1-14(25)4-7-17-12-20(28-27-3)22(26-2)21-19(17)11-16(13-24-21)10-15-5-8-18(23)9-6-15/h4-9,11-13H,10H2,1-3H3/b7-4+ |
| InChIKey | CPHFKBSVGAVHJG-QPJJXVBHSA-N |
| XLogP | 4.52 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|