C16H10Br2FNO — CID 58763099
5,7-dibromo-3-[(4-fluorophenyl)methyl]quinolin-8-ol (PubChem CID 58763099) has the molecular formula C16H10Br2FNO and a molecular weight of 411.07 g/mol. Its IUPAC name is 5,7-dibromo-3-[(4-fluorophenyl)methyl]quinolin-8-ol.
| Compound Name | 5,7-dibromo-3-[(4-fluorophenyl)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 58763099 |
| Molecular Formula | C16H10Br2FNO |
| Molecular Weight | 411.07 g/mol |
| Exact Mass | 408.91 |
| IUPAC Name | 5,7-dibromo-3-[(4-fluorophenyl)methyl]quinolin-8-ol |
| SMILES | Oc1c(Br)cc(Br)c2cc(Cc3ccc(F)cc3)cnc12 |
| InChI | InChI=1S/C16H10Br2FNO/c17-13-7-14(18)16(21)15-12(13)6-10(8-20-15)5-9-1-3-11(19)4-2-9/h1-4,6-8,21H,5H2 |
| InChIKey | PLIRYLSOVKAAEK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.07 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |