C16H21N3 — CID 58622263
1-[(2S)-1-methylpyrrolidin-2-yl]-N-(quinolin-2-ylmethyl)methanamine (PubChem CID 58622263) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is 1-[(2S)-1-methylpyrrolidin-2-yl]-N-(quinolin-2-ylmethyl)methanamine.
| Compound Name | 1-[(2S)-1-methylpyrrolidin-2-yl]-N-(quinolin-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 58622263 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 1-[(2S)-1-methylpyrrolidin-2-yl]-N-(quinolin-2-ylmethyl)methanamine |
| SMILES | CN1CCC[C@H]1CNCc1ccc2ccccc2n1 |
| InChI | InChI=1S/C16H21N3/c1-19-10-4-6-15(19)12-17-11-14-9-8-13-5-2-3-7-16(13)18-14/h2-3,5,7-9,15,17H,4,6,10-12H2,1H3/t15-/m0/s1 |
| InChIKey | ZQMVBIQRTUTWNP-HNNXBMFYSA-N |
| XLogP | 2.42 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |