C9H16N4S — CID 115905144
1-(1-methylpyrrolidin-2-yl)-N-(thiadiazol-4-ylmethyl)methanamine (PubChem CID 115905144) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is 1-(1-methylpyrrolidin-2-yl)-N-(thiadiazol-4-ylmethyl)methanamine.
| Compound Name | 1-(1-methylpyrrolidin-2-yl)-N-(thiadiazol-4-ylmethyl)methanamine |
|---|---|
| PubChem CID | 115905144 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1-(1-methylpyrrolidin-2-yl)-N-(thiadiazol-4-ylmethyl)methanamine |
| SMILES | CN1CCCC1CNCc1csnn1 |
| InChI | InChI=1S/C9H16N4S/c1-13-4-2-3-9(13)6-10-5-8-7-14-12-11-8/h7,9-10H,2-6H2,1H3 |
| InChIKey | VVNWXZXDLMRMTF-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |