C14H20N6OS — CID 126930784
2-methyl-6-[2-[(thiadiazol-4-ylmethylamino)methyl]piperidin-1-yl]pyridazin-3-one (PubChem CID 126930784) has the molecular formula C14H20N6OS and a molecular weight of 320.42 g/mol. Its IUPAC name is 2-methyl-6-[2-[(thiadiazol-4-ylmethylamino)methyl]piperidin-1-yl]pyridazin-3-one.
| Compound Name | 2-methyl-6-[2-[(thiadiazol-4-ylmethylamino)methyl]piperidin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 126930784 |
| Molecular Formula | C14H20N6OS |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2-methyl-6-[2-[(thiadiazol-4-ylmethylamino)methyl]piperidin-1-yl]pyridazin-3-one |
| SMILES | Cn1nc(N2CCCCC2CNCc2csnn2)ccc1=O |
| InChI | InChI=1S/C14H20N6OS/c1-19-14(21)6-5-13(17-19)20-7-3-2-4-12(20)9-15-8-11-10-22-18-16-11/h5-6,10,12,15H,2-4,7-9H2,1H3 |
| InChIKey | GADMXFWPFLYREO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |