C15H22N6O — CID 126930486
3-[2-[[(1-methylimidazol-2-yl)methylamino]methyl]piperidin-1-yl]-1H-pyridazin-6-one (PubChem CID 126930486) has the molecular formula C15H22N6O and a molecular weight of 302.38 g/mol. Its IUPAC name is 3-[2-[[(1-methylimidazol-2-yl)methylamino]methyl]piperidin-1-yl]-1H-pyridazin-6-one.
| Compound Name | 3-[2-[[(1-methylimidazol-2-yl)methylamino]methyl]piperidin-1-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 126930486 |
| Molecular Formula | C15H22N6O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 3-[2-[[(1-methylimidazol-2-yl)methylamino]methyl]piperidin-1-yl]-1H-pyridazin-6-one |
| SMILES | Cn1ccnc1CNCC1CCCCN1c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C15H22N6O/c1-20-9-7-17-14(20)11-16-10-12-4-2-3-8-21(12)13-5-6-15(22)19-18-13/h5-7,9,12,16H,2-4,8,10-11H2,1H3,(H,19,22) |
| InChIKey | GNDZRBPUCFZQLO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |