C16H26N4O2 — CID 126930538
3-[2-[[(1-hydroxycyclopentyl)methylamino]methyl]piperidin-1-yl]-1H-pyridazin-6-one (PubChem CID 126930538) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 3-[2-[[(1-hydroxycyclopentyl)methylamino]methyl]piperidin-1-yl]-1H-pyridazin-6-one.
| Compound Name | 3-[2-[[(1-hydroxycyclopentyl)methylamino]methyl]piperidin-1-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 126930538 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 3-[2-[[(1-hydroxycyclopentyl)methylamino]methyl]piperidin-1-yl]-1H-pyridazin-6-one |
| SMILES | O=c1ccc(N2CCCCC2CNCC2(O)CCCC2)n[nH]1 |
| InChI | InChI=1S/C16H26N4O2/c21-15-7-6-14(18-19-15)20-10-4-1-5-13(20)11-17-12-16(22)8-2-3-9-16/h6-7,13,17,22H,1-5,8-12H2,(H,19,21) |
| InChIKey | NTIGLHYAVCRUEH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |