C16H23N7O — CID 126930439
3-[2-[[[6-(dimethylamino)pyrimidin-4-yl]amino]methyl]piperidin-1-yl]-1H-pyridazin-6-one (PubChem CID 126930439) has the molecular formula C16H23N7O and a molecular weight of 329.41 g/mol. Its IUPAC name is 3-[2-[[[6-(dimethylamino)pyrimidin-4-yl]amino]methyl]piperidin-1-yl]-1H-pyridazin-6-one.
| Compound Name | 3-[2-[[[6-(dimethylamino)pyrimidin-4-yl]amino]methyl]piperidin-1-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 126930439 |
| Molecular Formula | C16H23N7O |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 3-[2-[[[6-(dimethylamino)pyrimidin-4-yl]amino]methyl]piperidin-1-yl]-1H-pyridazin-6-one |
| SMILES | CN(C)c1cc(NCC2CCCCN2c2ccc(=O)[nH]n2)ncn1 |
| InChI | InChI=1S/C16H23N7O/c1-22(2)15-9-13(18-11-19-15)17-10-12-5-3-4-8-23(12)14-6-7-16(24)21-20-14/h6-7,9,11-12H,3-5,8,10H2,1-2H3,(H,21,24)(H,17,18,19) |
| InChIKey | ZMYMKOCXLNNXIZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |