C16H24N2 — CID 103739294
N-[(2-cyclopropylphenyl)methyl]-1-(1-methylpyrrolidin-2-yl)methanamine (PubChem CID 103739294) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is N-[(2-cyclopropylphenyl)methyl]-1-(1-methylpyrrolidin-2-yl)methanamine.
| Compound Name | N-[(2-cyclopropylphenyl)methyl]-1-(1-methylpyrrolidin-2-yl)methanamine |
|---|---|
| PubChem CID | 103739294 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N-[(2-cyclopropylphenyl)methyl]-1-(1-methylpyrrolidin-2-yl)methanamine |
| SMILES | CN1CCCC1CNCc1ccccc1C1CC1 |
| InChI | InChI=1S/C16H24N2/c1-18-10-4-6-15(18)12-17-11-14-5-2-3-7-16(14)13-8-9-13/h2-3,5,7,13,15,17H,4,6,8-12H2,1H3 |
| InChIKey | RKWRWJMXIAORBL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |