C20H25NO3 — CID 140863633
(2R)-4-(dibenzylamino)-6-methyloxane-2,3-diol (PubChem CID 140863633) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is (2R)-4-(dibenzylamino)-6-methyloxane-2,3-diol.
| Compound Name | (2R)-4-(dibenzylamino)-6-methyloxane-2,3-diol |
|---|---|
| PubChem CID | 140863633 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (2R)-4-(dibenzylamino)-6-methyloxane-2,3-diol |
| SMILES | CC1CC(N(Cc2ccccc2)Cc2ccccc2)C(O)[C@H](O)O1 |
| InChI | InChI=1S/C20H25NO3/c1-15-12-18(19(22)20(23)24-15)21(13-16-8-4-2-5-9-16)14-17-10-6-3-7-11-17/h2-11,15,18-20,22-23H,12-14H2,1H3/t15?,18?,19?,20-/m1/s1 |
| InChIKey | IXXGOFZXXZHBBX-LHRBRMLMSA-N |
| XLogP | 2.55 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |