C23H31NO3 — CID 134310462
4-(dibenzylamino)-6-methyl-2-propan-2-yloxyoxan-3-ol (PubChem CID 134310462) has the molecular formula C23H31NO3 and a molecular weight of 369.50 g/mol. Its IUPAC name is 4-(dibenzylamino)-6-methyl-2-propan-2-yloxyoxan-3-ol.
| Compound Name | 4-(dibenzylamino)-6-methyl-2-propan-2-yloxyoxan-3-ol |
|---|---|
| PubChem CID | 134310462 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 4-(dibenzylamino)-6-methyl-2-propan-2-yloxyoxan-3-ol |
| SMILES | CC(C)OC1OC(C)CC(N(Cc2ccccc2)Cc2ccccc2)C1O |
| InChI | InChI=1S/C23H31NO3/c1-17(2)26-23-22(25)21(14-18(3)27-23)24(15-19-10-6-4-7-11-19)16-20-12-8-5-9-13-20/h4-13,17-18,21-23,25H,14-16H2,1-3H3 |
| InChIKey | KKVYOSXEIJRTOE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |