C44H55NO9 — CID 122574582
[4-(dibenzylamino)-2-[(2R,3R,4R,6R)-4-methoxy-4,6-dimethyl-7-oxo-2-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)heptan-3-yl]oxy-6-methyloxan-3-yl] benzoate (PubChem CID 122574582) has the molecular formula C44H55NO9 and a molecular weight of 741.92 g/mol. Its IUPAC name is [4-(dibenzylamino)-2-[(2R,3R,4R,6R)-4-methoxy-4,6-dimethyl-7-oxo-2-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)heptan-3-yl]oxy-6-methyloxan-3-yl] benzoate.
| Compound Name | [4-(dibenzylamino)-2-[(2R,3R,4R,6R)-4-methoxy-4,6-dimethyl-7-oxo-2-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)heptan-3-yl]oxy-6-methyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 122574582 |
| Molecular Formula | C44H55NO9 |
| Molecular Weight | 741.92 g/mol |
| Exact Mass | 741.39 |
| IUPAC Name | [4-(dibenzylamino)-2-[(2R,3R,4R,6R)-4-methoxy-4,6-dimethyl-7-oxo-2-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)heptan-3-yl]oxy-6-methyloxan-3-yl] benzoate |
| SMILES | CO[C@](C)(C[C@@H](C)C=O)[C@H](OC1OC(C)CC(N(Cc2ccccc2)Cc2ccccc2)C1OC(=O)c1ccccc1)[C@@H](C)C1=C(C)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C44H55NO9/c1-29(28-46)25-44(7,49-8)39(31(3)37-32(4)40(47)54-43(5,6)53-37)52-42-38(51-41(48)35-22-16-11-17-23-35)36(24-30(2)50-42)45(26-33-18-12-9-13-19-33)27-34-20-14-10-15-21-34/h9-23,28-31,36,38-39,42H,24-27H2,1-8H3/t29-,30?,31+,36?,38?,39-,42?,44-/m1/s1 |
| InChIKey | DZZOCQWTCSOIGT-RXAVWYKXSA-N |
| XLogP | 7.65 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.92 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|