C25H43NO6 — CID 161478356
6-[(3R,4R)-3-[(2S)-4-(dimethylamino)-3,6-dimethyloxan-2-yl]oxy-4-methoxy-4-methylhept-6-en-2-yl]-2,2,5-trimethyl-1,3-dioxin-4-one (PubChem CID 161478356) has the molecular formula C25H43NO6 and a molecular weight of 453.62 g/mol. Its IUPAC name is 6-[(3R,4R)-3-[(2S)-4-(dimethylamino)-3,6-dimethyloxan-2-yl]oxy-4-methoxy-4-methylhept-6-en-2-yl]-2,2,5-trimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(3R,4R)-3-[(2S)-4-(dimethylamino)-3,6-dimethyloxan-2-yl]oxy-4-methoxy-4-methylhept-6-en-2-yl]-2,2,5-trimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 161478356 |
| Molecular Formula | C25H43NO6 |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.31 |
| IUPAC Name | 6-[(3R,4R)-3-[(2S)-4-(dimethylamino)-3,6-dimethyloxan-2-yl]oxy-4-methoxy-4-methylhept-6-en-2-yl]-2,2,5-trimethyl-1,3-dioxin-4-one |
| SMILES | C=CC[C@@](C)(OC)[C@H](O[C@@H]1OC(C)CC(N(C)C)C1C)C(C)C1=C(C)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C25H43NO6/c1-12-13-25(8,28-11)21(17(4)20-18(5)22(27)32-24(6,7)31-20)30-23-16(3)19(26(9)10)14-15(2)29-23/h12,15-17,19,21,23H,1,13-14H2,2-11H3/t15?,16?,17?,19?,21-,23+,25-/m1/s1 |
| InChIKey | GADHCICBQFWRQV-UIHVMQCWSA-N |
| XLogP | 4.27 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|