C26H44NO8P — CID 134544366
(3R,5R,6R,7R)-6-[(2S)-4-(dimethylamino)-6-methyl-3-phosphorosooxan-2-yl]oxy-5-methoxy-3,5-dimethyl-7-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)octanal (PubChem CID 134544366) has the molecular formula C26H44NO8P and a molecular weight of 529.61 g/mol. Its IUPAC name is (3R,5R,6R,7R)-6-[(2S)-4-(dimethylamino)-6-methyl-3-phosphorosooxan-2-yl]oxy-5-methoxy-3,5-dimethyl-7-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)octanal.
| Compound Name | (3R,5R,6R,7R)-6-[(2S)-4-(dimethylamino)-6-methyl-3-phosphorosooxan-2-yl]oxy-5-methoxy-3,5-dimethyl-7-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)octanal |
|---|---|
| PubChem CID | 134544366 |
| Molecular Formula | C26H44NO8P |
| Molecular Weight | 529.61 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | (3R,5R,6R,7R)-6-[(2S)-4-(dimethylamino)-6-methyl-3-phosphorosooxan-2-yl]oxy-5-methoxy-3,5-dimethyl-7-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)octanal |
| SMILES | CO[C@](C)(C[C@@H](C)CC=O)[C@H](O[C@@H]1OC(C)CC(N(C)C)C1P=O)[C@@H](C)C1=C(C)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C26H44NO8P/c1-15(11-12-28)14-26(7,31-10)22(17(3)20-18(4)23(29)35-25(5,6)34-20)33-24-21(36-30)19(27(8)9)13-16(2)32-24/h12,15-17,19,21-22,24H,11,13-14H2,1-10H3/t15-,16?,17-,19?,21?,22+,24-,26+/m0/s1 |
| InChIKey | YEXQOXRUDNIMQZ-BMOGLVMASA-N |
| XLogP | 4.34 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|