C28H48NO7P — CID 158028372
6-[(2R,3R,4R,6S)-3-[(2S,3R,6R)-4-(dimethylamino)-6-methyl-3-phosphorosooxan-2-yl]oxy-4,6-dimethyl-4-prop-2-enoxyoctan-2-yl]-2,2,5-trimethyl-1,3-dioxin-4-one (PubChem CID 158028372) has the molecular formula C28H48NO7P and a molecular weight of 541.67 g/mol. Its IUPAC name is 6-[(2R,3R,4R,6S)-3-[(2S,3R,6R)-4-(dimethylamino)-6-methyl-3-phosphorosooxan-2-yl]oxy-4,6-dimethyl-4-prop-2-enoxyoctan-2-yl]-2,2,5-trimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(2R,3R,4R,6S)-3-[(2S,3R,6R)-4-(dimethylamino)-6-methyl-3-phosphorosooxan-2-yl]oxy-4,6-dimethyl-4-prop-2-enoxyoctan-2-yl]-2,2,5-trimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 158028372 |
| Molecular Formula | C28H48NO7P |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | 6-[(2R,3R,4R,6S)-3-[(2S,3R,6R)-4-(dimethylamino)-6-methyl-3-phosphorosooxan-2-yl]oxy-4,6-dimethyl-4-prop-2-enoxyoctan-2-yl]-2,2,5-trimethyl-1,3-dioxin-4-one |
| SMILES | C=CCO[C@](C)(C[C@@H](C)CC)[C@H](O[C@@H]1O[C@H](C)CC(N(C)C)[C@H]1P=O)[C@@H](C)C1=C(C)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C28H48NO7P/c1-12-14-32-28(9,16-17(3)13-2)24(19(5)22-20(6)25(30)36-27(7,8)35-22)34-26-23(37-31)21(29(10)11)15-18(4)33-26/h12,17-19,21,23-24,26H,1,13-16H2,2-11H3/t17-,18+,19-,21?,23+,24+,26-,28+/m0/s1 |
| InChIKey | SVDGFQKRAXQVIW-LIUZXMQSSA-N |
| XLogP | 5.71 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|