C29H51NO6 — CID 174067826
6-[(2R,3R,4R,6S)-3-[(2S,6R)-4-(dimethylamino)-3,6-dimethyloxan-2-yl]oxy-4,6-dimethyl-4-prop-2-enoxyoctan-2-yl]-2,2,5-trimethyl-1,3-dioxin-4-one (PubChem CID 174067826) has the molecular formula C29H51NO6 and a molecular weight of 509.73 g/mol. Its IUPAC name is 6-[(2R,3R,4R,6S)-3-[(2S,6R)-4-(dimethylamino)-3,6-dimethyloxan-2-yl]oxy-4,6-dimethyl-4-prop-2-enoxyoctan-2-yl]-2,2,5-trimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(2R,3R,4R,6S)-3-[(2S,6R)-4-(dimethylamino)-3,6-dimethyloxan-2-yl]oxy-4,6-dimethyl-4-prop-2-enoxyoctan-2-yl]-2,2,5-trimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 174067826 |
| Molecular Formula | C29H51NO6 |
| Molecular Weight | 509.73 g/mol |
| Exact Mass | 509.37 |
| IUPAC Name | 6-[(2R,3R,4R,6S)-3-[(2S,6R)-4-(dimethylamino)-3,6-dimethyloxan-2-yl]oxy-4,6-dimethyl-4-prop-2-enoxyoctan-2-yl]-2,2,5-trimethyl-1,3-dioxin-4-one |
| SMILES | C=CCO[C@](C)(C[C@@H](C)CC)[C@H](O[C@@H]1O[C@H](C)CC(N(C)C)C1C)[C@@H](C)C1=C(C)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C29H51NO6/c1-13-15-32-29(10,17-18(3)14-2)25(21(6)24-22(7)26(31)36-28(8,9)35-24)34-27-20(5)23(30(11)12)16-19(4)33-27/h13,18-21,23,25,27H,1,14-17H2,2-12H3/t18-,19+,20?,21-,23?,25+,27-,29+/m0/s1 |
| InChIKey | RXWKXYADGBCOFU-UGFZBSMBSA-N |
| XLogP | 5.69 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.73 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|