C25H41FNO8P — CID 134544600
(4R,5R,6R)-5-[(2S)-4-(dimethylamino)-6-methyl-3-phosphorosooxan-2-yl]oxy-2-fluoro-4-methoxy-2,4-dimethyl-6-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)heptanal (PubChem CID 134544600) has the molecular formula C25H41FNO8P and a molecular weight of 533.57 g/mol. Its IUPAC name is (4R,5R,6R)-5-[(2S)-4-(dimethylamino)-6-methyl-3-phosphorosooxan-2-yl]oxy-2-fluoro-4-methoxy-2,4-dimethyl-6-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)heptanal.
| Compound Name | (4R,5R,6R)-5-[(2S)-4-(dimethylamino)-6-methyl-3-phosphorosooxan-2-yl]oxy-2-fluoro-4-methoxy-2,4-dimethyl-6-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)heptanal |
|---|---|
| PubChem CID | 134544600 |
| Molecular Formula | C25H41FNO8P |
| Molecular Weight | 533.57 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | (4R,5R,6R)-5-[(2S)-4-(dimethylamino)-6-methyl-3-phosphorosooxan-2-yl]oxy-2-fluoro-4-methoxy-2,4-dimethyl-6-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)heptanal |
| SMILES | CO[C@](C)(CC(C)(F)C=O)[C@H](O[C@@H]1OC(C)CC(N(C)C)C1P=O)[C@@H](C)C1=C(C)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C25H41FNO8P/c1-14-11-17(27(8)9)19(36-30)22(32-14)33-20(25(7,31-10)12-24(6,26)13-28)15(2)18-16(3)21(29)35-23(4,5)34-18/h13-15,17,19-20,22H,11-12H2,1-10H3/t14?,15-,17?,19?,20+,22-,24?,25+/m0/s1 |
| InChIKey | BMCAKTPVIFBFEQ-ZCASYYCJSA-N |
| XLogP | 4.04 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|