C25H43NO7 — CID 175177047
(2R,4R,5R,6R)-5-[(2S,4R,6R)-4-(dimethylamino)-6-methyloxan-2-yl]oxy-4-methoxy-2,4-dimethyl-6-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)heptanal (PubChem CID 175177047) has the molecular formula C25H43NO7 and a molecular weight of 469.62 g/mol. Its IUPAC name is (2R,4R,5R,6R)-5-[(2S,4R,6R)-4-(dimethylamino)-6-methyloxan-2-yl]oxy-4-methoxy-2,4-dimethyl-6-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)heptanal.
| Compound Name | (2R,4R,5R,6R)-5-[(2S,4R,6R)-4-(dimethylamino)-6-methyloxan-2-yl]oxy-4-methoxy-2,4-dimethyl-6-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)heptanal |
|---|---|
| PubChem CID | 175177047 |
| Molecular Formula | C25H43NO7 |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.30 |
| IUPAC Name | (2R,4R,5R,6R)-5-[(2S,4R,6R)-4-(dimethylamino)-6-methyloxan-2-yl]oxy-4-methoxy-2,4-dimethyl-6-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)heptanal |
| SMILES | CO[C@](C)(C[C@@H](C)C=O)[C@H](O[C@H]1C[C@H](N(C)C)C[C@@H](C)O1)[C@@H](C)C1=C(C)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C25H43NO7/c1-15(14-27)13-25(7,29-10)22(31-20-12-19(26(8)9)11-16(2)30-20)17(3)21-18(4)23(28)33-24(5,6)32-21/h14-17,19-20,22H,11-13H2,1-10H3/t15-,16-,17+,19-,20+,22-,25-/m1/s1 |
| InChIKey | CJGZVZOXSCQFLJ-LNXFQPDXSA-N |
| XLogP | 3.68 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|