C37H58N2O9 — CID 166758000
[(2S,3R,4S,6R)-4-(dimethylamino)-2-[7-(1-hydroxypent-4-en-2-ylamino)-4-methoxy-4,6-dimethyl-2-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)heptan-3-yl]oxy-6-methyloxan-3-yl] benzoate (PubChem CID 166758000) has the molecular formula C37H58N2O9 and a molecular weight of 674.88 g/mol. Its IUPAC name is [(2S,3R,4S,6R)-4-(dimethylamino)-2-[7-(1-hydroxypent-4-en-2-ylamino)-4-methoxy-4,6-dimethyl-2-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)heptan-3-yl]oxy-6-methyloxan-3-yl] benzoate.
| Compound Name | [(2S,3R,4S,6R)-4-(dimethylamino)-2-[7-(1-hydroxypent-4-en-2-ylamino)-4-methoxy-4,6-dimethyl-2-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)heptan-3-yl]oxy-6-methyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 166758000 |
| Molecular Formula | C37H58N2O9 |
| Molecular Weight | 674.88 g/mol |
| Exact Mass | 674.41 |
| IUPAC Name | [(2S,3R,4S,6R)-4-(dimethylamino)-2-[7-(1-hydroxypent-4-en-2-ylamino)-4-methoxy-4,6-dimethyl-2-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)heptan-3-yl]oxy-6-methyloxan-3-yl] benzoate |
| SMILES | C=CCC(CO)NCC(C)CC(C)(OC)C(O[C@@H]1O[C@H](C)C[C@H](N(C)C)[C@H]1OC(=O)c1ccccc1)C(C)C1=C(C)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C37H58N2O9/c1-12-16-28(22-40)38-21-23(2)20-37(8,43-11)32(25(4)30-26(5)33(41)48-36(6,7)47-30)46-35-31(29(39(9)10)19-24(3)44-35)45-34(42)27-17-14-13-15-18-27/h12-15,17-18,23-25,28-29,31-32,35,38,40H,1,16,19-22H2,2-11H3/t23?,24-,25?,28?,29+,31-,32?,35+,37?/m1/s1 |
| InChIKey | BSLMCZLBMDDPEL-MBSXIINQSA-N |
| XLogP | 4.84 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.88 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|