C25H26N4O4S2 — CID 67873381
N-[2-[isoquinolin-5-ylsulfonyl(methyl)amino]cyclohexyl]isoquinoline-5-sulfonamide (PubChem CID 67873381) has the molecular formula C25H26N4O4S2 and a molecular weight of 510.64 g/mol. Its IUPAC name is N-[2-[isoquinolin-5-ylsulfonyl(methyl)amino]cyclohexyl]isoquinoline-5-sulfonamide.
| Compound Name | N-[2-[isoquinolin-5-ylsulfonyl(methyl)amino]cyclohexyl]isoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 67873381 |
| Molecular Formula | C25H26N4O4S2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | N-[2-[isoquinolin-5-ylsulfonyl(methyl)amino]cyclohexyl]isoquinoline-5-sulfonamide |
| SMILES | CN(C1CCCCC1NS(=O)(=O)c1cccc2cnccc12)S(=O)(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C25H26N4O4S2/c1-29(35(32,33)25-11-5-7-19-17-27-15-13-21(19)25)23-9-3-2-8-22(23)28-34(30,31)24-10-4-6-18-16-26-14-12-20(18)24/h4-7,10-17,22-23,28H,2-3,8-9H2,1H3 |
| InChIKey | RNWDEJUHURELKC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |