C15H19NO4S — CID 60950243
2-[cyclopentyl(prop-2-enyl)sulfamoyl]benzoic acid (PubChem CID 60950243) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-[cyclopentyl(prop-2-enyl)sulfamoyl]benzoic acid.
| Compound Name | 2-[cyclopentyl(prop-2-enyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 60950243 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-[cyclopentyl(prop-2-enyl)sulfamoyl]benzoic acid |
| SMILES | C=CCN(C1CCCC1)S(=O)(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C15H19NO4S/c1-2-11-16(12-7-3-4-8-12)21(19,20)14-10-6-5-9-13(14)15(17)18/h2,5-6,9-10,12H,1,3-4,7-8,11H2,(H,17,18) |
| InChIKey | WYEVZILWRNITRV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|