C20H31NO2S — CID 3670403
N-cyclohexyl-2,3,4,5,6-pentamethyl-N-prop-2-enylbenzenesulfonamide (PubChem CID 3670403) has the molecular formula C20H31NO2S and a molecular weight of 349.54 g/mol. Its IUPAC name is N-cyclohexyl-2,3,4,5,6-pentamethyl-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-cyclohexyl-2,3,4,5,6-pentamethyl-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 3670403 |
| Molecular Formula | C20H31NO2S |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | N-cyclohexyl-2,3,4,5,6-pentamethyl-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(C1CCCCC1)S(=O)(=O)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C20H31NO2S/c1-7-13-21(19-11-9-8-10-12-19)24(22,23)20-17(5)15(3)14(2)16(4)18(20)6/h7,19H,1,8-13H2,2-6H3 |
| InChIKey | MPSZHZYRRZVFLT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|