C17H26BrNO2S — CID 91670159
3-bromo-N-cyclohexyl-N-ethyl-2,4,6-trimethylbenzenesulfonamide (PubChem CID 91670159) has the molecular formula C17H26BrNO2S and a molecular weight of 388.37 g/mol. Its IUPAC name is 3-bromo-N-cyclohexyl-N-ethyl-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | 3-bromo-N-cyclohexyl-N-ethyl-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 91670159 |
| Molecular Formula | C17H26BrNO2S |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 3-bromo-N-cyclohexyl-N-ethyl-2,4,6-trimethylbenzenesulfonamide |
| SMILES | CCN(C1CCCCC1)S(=O)(=O)c1c(C)cc(C)c(Br)c1C |
| InChI | InChI=1S/C17H26BrNO2S/c1-5-19(15-9-7-6-8-10-15)22(20,21)17-13(3)11-12(2)16(18)14(17)4/h11,15H,5-10H2,1-4H3 |
| InChIKey | WDLLJMVDZRBGHR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |