C14H17BrFNO2S — CID 116528239
4-bromo-N-cyclopentyl-2-fluoro-N-prop-2-enylbenzenesulfonamide (PubChem CID 116528239) has the molecular formula C14H17BrFNO2S and a molecular weight of 362.26 g/mol. Its IUPAC name is 4-bromo-N-cyclopentyl-2-fluoro-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 4-bromo-N-cyclopentyl-2-fluoro-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 116528239 |
| Molecular Formula | C14H17BrFNO2S |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 4-bromo-N-cyclopentyl-2-fluoro-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(C1CCCC1)S(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C14H17BrFNO2S/c1-2-9-17(12-5-3-4-6-12)20(18,19)14-8-7-11(15)10-13(14)16/h2,7-8,10,12H,1,3-6,9H2 |
| InChIKey | MAYPZSMJPMBXQE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|