C13H18N2O3S2 — CID 102862565
2-[cyclobutyl(2-hydroxyethyl)sulfamoyl]benzenecarbothioamide (PubChem CID 102862565) has the molecular formula C13H18N2O3S2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-[cyclobutyl(2-hydroxyethyl)sulfamoyl]benzenecarbothioamide.
| Compound Name | 2-[cyclobutyl(2-hydroxyethyl)sulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 102862565 |
| Molecular Formula | C13H18N2O3S2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-[cyclobutyl(2-hydroxyethyl)sulfamoyl]benzenecarbothioamide |
| SMILES | NC(=S)c1ccccc1S(=O)(=O)N(CCO)C1CCC1 |
| InChI | InChI=1S/C13H18N2O3S2/c14-13(19)11-6-1-2-7-12(11)20(17,18)15(8-9-16)10-4-3-5-10/h1-2,6-7,10,16H,3-5,8-9H2,(H2,14,19) |
| InChIKey | VIZKLRWVCRSELM-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|