C20H26N2O3S2 — CID 101455621
4-methyl-N-[[[(2R)-4-methylpent-3-en-2-yl]amino]-(4-methylphenyl)-oxo-λ6-sulfanylidene]benzenesulfonamide (PubChem CID 101455621) has the molecular formula C20H26N2O3S2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 4-methyl-N-[[[(2R)-4-methylpent-3-en-2-yl]amino]-(4-methylphenyl)-oxo-λ6-sulfanylidene]benzenesulfonamide.
| Compound Name | 4-methyl-N-[[[(2R)-4-methylpent-3-en-2-yl]amino]-(4-methylphenyl)-oxo-λ6-sulfanylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 101455621 |
| Molecular Formula | C20H26N2O3S2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 4-methyl-N-[[[(2R)-4-methylpent-3-en-2-yl]amino]-(4-methylphenyl)-oxo-λ6-sulfanylidene]benzenesulfonamide |
| SMILES | CC(C)=C[C@@H](C)NS(=O)(=NS(=O)(=O)c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H26N2O3S2/c1-15(2)14-18(5)21-26(23,19-10-6-16(3)7-11-19)22-27(24,25)20-12-8-17(4)9-13-20/h6-14,18H,1-5H3,(H,21,22,23)/t18-,26?/m1/s1 |
| InChIKey | XQRZEJPEQXTYPP-QOBPCVTDSA-N |
| XLogP | 4.38 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|