C24H25NO3S2 — CID 134933102
4-methyl-N-[oxo-phenyl-[(E)-5-phenylpent-2-en-2-yl]-λ6-sulfanylidene]benzenesulfonamide (PubChem CID 134933102) has the molecular formula C24H25NO3S2 and a molecular weight of 439.60 g/mol. Its IUPAC name is 4-methyl-N-[oxo-phenyl-[(E)-5-phenylpent-2-en-2-yl]-λ6-sulfanylidene]benzenesulfonamide.
| Compound Name | 4-methyl-N-[oxo-phenyl-[(E)-5-phenylpent-2-en-2-yl]-λ6-sulfanylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 134933102 |
| Molecular Formula | C24H25NO3S2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 4-methyl-N-[oxo-phenyl-[(E)-5-phenylpent-2-en-2-yl]-λ6-sulfanylidene]benzenesulfonamide |
| SMILES | C/C(=C\CCc1ccccc1)[S@](=O)(=NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H25NO3S2/c1-20-16-18-24(19-17-20)30(27,28)25-29(26,23-14-7-4-8-15-23)21(2)10-9-13-22-11-5-3-6-12-22/h3-8,10-12,14-19H,9,13H2,1-2H3/b21-10+/t29-/m1/s1 |
| InChIKey | XKDSUFJZXSHCIE-UJCVRBOOSA-N |
| XLogP | 5.75 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |