C24H31NO2S — CID 101486933
2,2-dimethyl-3-[(E)-3-methyl-6-phenylhex-3-enyl]-1-(4-methylphenyl)sulfonylaziridine (PubChem CID 101486933) has the molecular formula C24H31NO2S and a molecular weight of 397.58 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(E)-3-methyl-6-phenylhex-3-enyl]-1-(4-methylphenyl)sulfonylaziridine.
| Compound Name | 2,2-dimethyl-3-[(E)-3-methyl-6-phenylhex-3-enyl]-1-(4-methylphenyl)sulfonylaziridine |
|---|---|
| PubChem CID | 101486933 |
| Molecular Formula | C24H31NO2S |
| Molecular Weight | 397.58 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 2,2-dimethyl-3-[(E)-3-methyl-6-phenylhex-3-enyl]-1-(4-methylphenyl)sulfonylaziridine |
| SMILES | C/C(=C\CCc1ccccc1)CCC1N(S(=O)(=O)c2ccc(C)cc2)C1(C)C |
| InChI | InChI=1S/C24H31NO2S/c1-19(9-8-12-21-10-6-5-7-11-21)15-18-23-24(3,4)25(23)28(26,27)22-16-13-20(2)14-17-22/h5-7,9-11,13-14,16-17,23H,8,12,15,18H2,1-4H3/b19-9+ |
| InChIKey | WLUQRKKYRZGILP-DJKKODMXSA-N |
| XLogP | 5.51 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|