C29H39NO2S — CID 134942159
3-[(7E)-3,7-dimethyl-10-phenyldeca-3,7-dienyl]-2,2-dimethyl-1-(4-methylphenyl)sulfonylaziridine (PubChem CID 134942159) has the molecular formula C29H39NO2S and a molecular weight of 465.70 g/mol. Its IUPAC name is 3-[(7E)-3,7-dimethyl-10-phenyldeca-3,7-dienyl]-2,2-dimethyl-1-(4-methylphenyl)sulfonylaziridine.
| Compound Name | 3-[(7E)-3,7-dimethyl-10-phenyldeca-3,7-dienyl]-2,2-dimethyl-1-(4-methylphenyl)sulfonylaziridine |
|---|---|
| PubChem CID | 134942159 |
| Molecular Formula | C29H39NO2S |
| Molecular Weight | 465.70 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | 3-[(7E)-3,7-dimethyl-10-phenyldeca-3,7-dienyl]-2,2-dimethyl-1-(4-methylphenyl)sulfonylaziridine |
| SMILES | CC(=CCC/C(C)=C/CCc1ccccc1)CCC1N(S(=O)(=O)c2ccc(C)cc2)C1(C)C |
| InChI | InChI=1S/C29H39NO2S/c1-23(13-10-16-26-14-7-6-8-15-26)11-9-12-24(2)19-22-28-29(4,5)30(28)33(31,32)27-20-17-25(3)18-21-27/h6-8,12-15,17-18,20-21,28H,9-11,16,19,22H2,1-5H3/b23-13+,24-12? |
| InChIKey | IWBHGTHEAWYCLE-RXOMYYIVSA-N |
| XLogP | 7.23 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.70 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|