C24H34O4S — CID 86133811
4-methylbenzenesulfonic acid;11-phenylundec-8-en-1-ol (PubChem CID 86133811) has the molecular formula C24H34O4S and a molecular weight of 418.60 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;11-phenylundec-8-en-1-ol.
| Compound Name | 4-methylbenzenesulfonic acid;11-phenylundec-8-en-1-ol |
|---|---|
| PubChem CID | 86133811 |
| Molecular Formula | C24H34O4S |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 4-methylbenzenesulfonic acid;11-phenylundec-8-en-1-ol |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.OCCCCCCCC=CCCc1ccccc1 |
| InChI | InChI=1S/C17H26O.C7H8O3S/c18-16-12-7-5-3-1-2-4-6-9-13-17-14-10-8-11-15-17;1-6-2-4-7(5-3-6)11(8,9)10/h4,6,8,10-11,14-15,18H,1-3,5,7,9,12-13,16H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | IVYBIIFCSJWQEJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|