C23H29NO4S2 — CID 102388143
N-[[(2Z,4Z)-1-hydroxynona-2,4-dien-4-yl]-(4-methylphenyl)-oxo-λ6-sulfanylidene]-4-methylbenzenesulfonamide (PubChem CID 102388143) has the molecular formula C23H29NO4S2 and a molecular weight of 447.62 g/mol. Its IUPAC name is N-[[(2Z,4Z)-1-hydroxynona-2,4-dien-4-yl]-(4-methylphenyl)-oxo-λ6-sulfanylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[[(2Z,4Z)-1-hydroxynona-2,4-dien-4-yl]-(4-methylphenyl)-oxo-λ6-sulfanylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102388143 |
| Molecular Formula | C23H29NO4S2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | N-[[(2Z,4Z)-1-hydroxynona-2,4-dien-4-yl]-(4-methylphenyl)-oxo-λ6-sulfanylidene]-4-methylbenzenesulfonamide |
| SMILES | CCCC/C=C(/C=C\CO)S(=O)(=NS(=O)(=O)c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H29NO4S2/c1-4-5-6-8-21(9-7-18-25)29(26,22-14-10-19(2)11-15-22)24-30(27,28)23-16-12-20(3)13-17-23/h7-17,25H,4-6,18H2,1-3H3/b9-7-,21-8- |
| InChIKey | XRCMEJVCQLNLJP-QUAGDTFVSA-N |
| XLogP | 5.14 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|